Pyridine-d5
General description
Pyridine-d5 is a deuterated NMR solvent useful in NMR-based research and analyses. It has been synthesized by palladium catalyzed H/D (hydrogen/deuterium) exchange reaction between pyridine vapor and heavy water. Infrared and Raman spectra of pyridine-d5 have been recorded in the range 300–4000cm-1.[1]
Application
Pyridine-d5 may be used as a solvent in the 1H NMR based structural analysis of lignin acetates obtained from spruce and birch.[2]
Properties
| Isotopic Purity | ≥99.5 atom % D |
| Quality Level | 200 |
| Assay |
≥99% (CP) |
| Form | Liquid |
| Expl. Lim. | 0.34-6.3 % (lit.) |
| Technique(s) | NMR: suitable |
| Impurities |
≤0.05% water water |
| Reflective Index |
n20/D 1.506 (lit.) |
| pH | 8.5 (0.2 g/L) |
| bp |
114.4 °C (lit.) |
| mp |
-41 °C (lit.) |
| Density |
1.05 g/mL at 25 °C (lit.) |
| Mass Shift | M+5 |
| SMILES String |
[2H]c1nc([2H])c([2H])c([2H])c1[2H] |
| InChl |
1S/C5H5N/c1-2-4-6-5-3-1/h1-5H/i1D,2D,3D,4D,5D |
| InChl Key |
JUJWROOIHBZHMG-RALIUCGRSA-N |
